C32H37ClN4O3 — CID 59092597
3-chloro-4-hydroxy-N-[(E)-[4-[2-oxo-2-[2-(2-piperidin-1-ylethyl)piperidin-1-yl]ethyl]naphthalen-1-yl]methylideneamino]benzamide (PubChem CID 59092597) has the molecular formula C32H37ClN4O3 and a molecular weight of 561.13 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(E)-[4-[2-oxo-2-[2-(2-piperidin-1-ylethyl)piperidin-1-yl]ethyl]naphthalen-1-yl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(E)-[4-[2-oxo-2-[2-(2-piperidin-1-ylethyl)piperidin-1-yl]ethyl]naphthalen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 59092597 |
| Molecular Formula | C32H37ClN4O3 |
| Molecular Weight | 561.13 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(E)-[4-[2-oxo-2-[2-(2-piperidin-1-ylethyl)piperidin-1-yl]ethyl]naphthalen-1-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccc(CC(=O)N2CCCCC2CCN2CCCCC2)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C32H37ClN4O3/c33-29-20-24(13-14-30(29)38)32(40)35-34-22-25-12-11-23(27-9-2-3-10-28(25)27)21-31(39)37-18-7-4-8-26(37)15-19-36-16-5-1-6-17-36/h2-3,9-14,20,22,26,38H,1,4-8,15-19,21H2,(H,35,40)/b34-22+ |
| InChIKey | JJBITNQHPCTVCQ-PPOKSSTKSA-N |
| XLogP | 5.76 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.13 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|