C23H19ClN2O2 — CID 59092689
3-chloro-4-hydroxy-N-[(E)-[3-[(E)-3-phenylprop-1-enyl]phenyl]methylideneamino]benzamide (PubChem CID 59092689) has the molecular formula C23H19ClN2O2 and a molecular weight of 390.87 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(E)-[3-[(E)-3-phenylprop-1-enyl]phenyl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(E)-[3-[(E)-3-phenylprop-1-enyl]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 59092689 |
| Molecular Formula | C23H19ClN2O2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(E)-[3-[(E)-3-phenylprop-1-enyl]phenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cccc(/C=C/Cc2ccccc2)c1)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C23H19ClN2O2/c24-21-15-20(12-13-22(21)27)23(28)26-25-16-19-11-5-10-18(14-19)9-4-8-17-6-2-1-3-7-17/h1-7,9-16,27H,8H2,(H,26,28)/b9-4+,25-16+ |
| InChIKey | XMXKQFNWKNGORG-TZMDPKHTSA-N |
| XLogP | 5.07 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|