C17H11ClN2O4 — CID 72514511
3-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl]prop-2-ynoic acid (PubChem CID 72514511) has the molecular formula C17H11ClN2O4 and a molecular weight of 342.74 g/mol. Its IUPAC name is 3-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl]prop-2-ynoic acid.
| Compound Name | 3-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl]prop-2-ynoic acid |
|---|---|
| PubChem CID | 72514511 |
| Molecular Formula | C17H11ClN2O4 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 3-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl]prop-2-ynoic acid |
| SMILES | O=C(O)C#Cc1ccc(C=NNC(=O)c2ccc(O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H11ClN2O4/c18-14-9-13(6-7-15(14)21)17(24)20-19-10-12-3-1-11(2-4-12)5-8-16(22)23/h1-4,6-7,9-10,21H,(H,20,24)(H,22,23) |
| InChIKey | JZMOXHUTNPLMCV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|