C19H17ClN2O4 — CID 72514634
5-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl]pent-4-enoic acid (PubChem CID 72514634) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is 5-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl]pent-4-enoic acid.
| Compound Name | 5-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 72514634 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 5-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl]pent-4-enoic acid |
| SMILES | O=C(O)CCC=Cc1ccc(C=NNC(=O)c2ccc(O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H17ClN2O4/c20-16-11-15(9-10-17(16)23)19(26)22-21-12-14-7-5-13(6-8-14)3-1-2-4-18(24)25/h1,3,5-12,23H,2,4H2,(H,22,26)(H,24,25) |
| InChIKey | NSODNGJKWXOJDQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|