C23H17ClN2O4S — CID 59092300
3-chloro-4-hydroxy-N-[(E)-[4-[2-(4-methylphenyl)sulfonylethynyl]phenyl]methylideneamino]benzamide (PubChem CID 59092300) has the molecular formula C23H17ClN2O4S and a molecular weight of 452.92 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(E)-[4-[2-(4-methylphenyl)sulfonylethynyl]phenyl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(E)-[4-[2-(4-methylphenyl)sulfonylethynyl]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 59092300 |
| Molecular Formula | C23H17ClN2O4S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(E)-[4-[2-(4-methylphenyl)sulfonylethynyl]phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)C#Cc2ccc(/C=N/NC(=O)c3ccc(O)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C23H17ClN2O4S/c1-16-2-9-20(10-3-16)31(29,30)13-12-17-4-6-18(7-5-17)15-25-26-23(28)19-8-11-22(27)21(24)14-19/h2-11,14-15,27H,1H3,(H,26,28)/b25-15+ |
| InChIKey | NKJQCTMDBWPGEP-MFKUBSTISA-N |
| XLogP | 3.90 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|