C24H19ClN2O3S — CID 87419278
3-chloro-4-hydroxy-N-[(E)-[3-[2-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]ethynyl]phenyl]methylideneamino]benzamide (PubChem CID 87419278) has the molecular formula C24H19ClN2O3S and a molecular weight of 450.95 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(E)-[3-[2-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]ethynyl]phenyl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(E)-[3-[2-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]ethynyl]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 87419278 |
| Molecular Formula | C24H19ClN2O3S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(E)-[3-[2-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]ethynyl]phenyl]methylideneamino]benzamide |
| SMILES | C=S(=O)(C#Cc1cccc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H19ClN2O3S/c1-17-6-9-21(10-7-17)31(2,30)13-12-18-4-3-5-19(14-18)16-26-27-24(29)20-8-11-23(28)22(25)15-20/h3-11,14-16,28H,2H2,1H3,(H,27,29)/b26-16+ |
| InChIKey | OQTLIVMGWVAODD-WGOQTCKBSA-N |
| XLogP | 4.20 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|