C29H33ClN4O4 — CID 87419230
N-[(E)-[4-[2-(4-benzylpiperazin-1-yl)ethoxy]-2-(1-hydroxyethyl)phenyl]methylideneamino]-3-chloro-4-hydroxybenzamide (PubChem CID 87419230) has the molecular formula C29H33ClN4O4 and a molecular weight of 537.06 g/mol. Its IUPAC name is N-[(E)-[4-[2-(4-benzylpiperazin-1-yl)ethoxy]-2-(1-hydroxyethyl)phenyl]methylideneamino]-3-chloro-4-hydroxybenzamide.
| Compound Name | N-[(E)-[4-[2-(4-benzylpiperazin-1-yl)ethoxy]-2-(1-hydroxyethyl)phenyl]methylideneamino]-3-chloro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 87419230 |
| Molecular Formula | C29H33ClN4O4 |
| Molecular Weight | 537.06 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | N-[(E)-[4-[2-(4-benzylpiperazin-1-yl)ethoxy]-2-(1-hydroxyethyl)phenyl]methylideneamino]-3-chloro-4-hydroxybenzamide |
| SMILES | CC(O)c1cc(OCCN2CCN(Cc3ccccc3)CC2)ccc1/C=N/NC(=O)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C29H33ClN4O4/c1-21(35)26-18-25(9-7-24(26)19-31-32-29(37)23-8-10-28(36)27(30)17-23)38-16-15-33-11-13-34(14-12-33)20-22-5-3-2-4-6-22/h2-10,17-19,21,35-36H,11-16,20H2,1H3,(H,32,37)/b31-19+ |
| InChIKey | DRDZIDYDPDHIEG-ZCTHSVRISA-N |
| XLogP | 4.06 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.06 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|