C35H36ClN3O3 — CID 90697788
N-[(Z)-[4-[2-(4-benzylpiperidin-1-yl)ethoxy]-3-methyl-5-phenylphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide (PubChem CID 90697788) has the molecular formula C35H36ClN3O3 and a molecular weight of 582.14 g/mol. Its IUPAC name is N-[(Z)-[4-[2-(4-benzylpiperidin-1-yl)ethoxy]-3-methyl-5-phenylphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide.
| Compound Name | N-[(Z)-[4-[2-(4-benzylpiperidin-1-yl)ethoxy]-3-methyl-5-phenylphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 90697788 |
| Molecular Formula | C35H36ClN3O3 |
| Molecular Weight | 582.14 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | N-[(Z)-[4-[2-(4-benzylpiperidin-1-yl)ethoxy]-3-methyl-5-phenylphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccc(O)c(Cl)c2)cc(-c2ccccc2)c1OCCN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C35H36ClN3O3/c1-25-20-28(24-37-38-35(41)30-12-13-33(40)32(36)23-30)22-31(29-10-6-3-7-11-29)34(25)42-19-18-39-16-14-27(15-17-39)21-26-8-4-2-5-9-26/h2-13,20,22-24,27,40H,14-19,21H2,1H3,(H,38,41)/b37-24- |
| InChIKey | TYXBQVSGHSAKAW-PNEAAFPUSA-N |
| XLogP | 7.12 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.14 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|