C30H26Cl3N3O4 — CID 87419237
3-chloro-N-[(E)-[4-[2-[(3,4-dichlorophenyl)methylamino]ethoxy]-3-methoxy-5-phenylphenyl]methylideneamino]-4-hydroxybenzamide (PubChem CID 87419237) has the molecular formula C30H26Cl3N3O4 and a molecular weight of 598.91 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[2-[(3,4-dichlorophenyl)methylamino]ethoxy]-3-methoxy-5-phenylphenyl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[2-[(3,4-dichlorophenyl)methylamino]ethoxy]-3-methoxy-5-phenylphenyl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 87419237 |
| Molecular Formula | C30H26Cl3N3O4 |
| Molecular Weight | 598.91 g/mol |
| Exact Mass | 597.10 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[2-[(3,4-dichlorophenyl)methylamino]ethoxy]-3-methoxy-5-phenylphenyl]methylideneamino]-4-hydroxybenzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)cc(-c2ccccc2)c1OCCNCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H26Cl3N3O4/c1-39-28-15-20(18-35-36-30(38)22-8-10-27(37)26(33)16-22)13-23(21-5-3-2-4-6-21)29(28)40-12-11-34-17-19-7-9-24(31)25(32)14-19/h2-10,13-16,18,34,37H,11-12,17H2,1H3,(H,36,38)/b35-18+ |
| InChIKey | GEBNXUDTKOZOKC-MWBNBJEGSA-N |
| XLogP | 6.96 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.91 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|