C31H31ClN4O3 — CID 91580492
N-[(Z)-[4-[2-[[4-(aminomethyl)phenyl]methylamino]ethoxy]-3-methyl-5-phenylphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide (PubChem CID 91580492) has the molecular formula C31H31ClN4O3 and a molecular weight of 543.07 g/mol. Its IUPAC name is N-[(Z)-[4-[2-[[4-(aminomethyl)phenyl]methylamino]ethoxy]-3-methyl-5-phenylphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide.
| Compound Name | N-[(Z)-[4-[2-[[4-(aminomethyl)phenyl]methylamino]ethoxy]-3-methyl-5-phenylphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 91580492 |
| Molecular Formula | C31H31ClN4O3 |
| Molecular Weight | 543.07 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | N-[(Z)-[4-[2-[[4-(aminomethyl)phenyl]methylamino]ethoxy]-3-methyl-5-phenylphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccc(O)c(Cl)c2)cc(-c2ccccc2)c1OCCNCc1ccc(CN)cc1 |
| InChI | InChI=1S/C31H31ClN4O3/c1-21-15-24(20-35-36-31(38)26-11-12-29(37)28(32)17-26)16-27(25-5-3-2-4-6-25)30(21)39-14-13-34-19-23-9-7-22(18-33)8-10-23/h2-12,15-17,20,34,37H,13-14,18-19,33H2,1H3,(H,36,38)/b35-20- |
| InChIKey | OFEVBLOQBWRWQF-OJYCWLPVSA-N |
| XLogP | 5.41 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.07 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|