C34H35ClN4O3 — CID 59091844
3-chloro-4-hydroxy-N-[(E)-[3-methyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethoxy]-5-phenylphenyl]methylideneamino]benzamide (PubChem CID 59091844) has the molecular formula C34H35ClN4O3 and a molecular weight of 583.13 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(E)-[3-methyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethoxy]-5-phenylphenyl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(E)-[3-methyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethoxy]-5-phenylphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 59091844 |
| Molecular Formula | C34H35ClN4O3 |
| Molecular Weight | 583.13 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(E)-[3-methyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethoxy]-5-phenylphenyl]methylideneamino]benzamide |
| SMILES | Cc1cccc(N2CCN(CCOc3c(C)cc(/C=N/NC(=O)c4ccc(O)c(Cl)c4)cc3-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C34H35ClN4O3/c1-24-7-6-10-29(19-24)39-15-13-38(14-16-39)17-18-42-33-25(2)20-26(21-30(33)27-8-4-3-5-9-27)23-36-37-34(41)28-11-12-32(40)31(35)22-28/h3-12,19-23,40H,13-18H2,1-2H3,(H,37,41)/b36-23+ |
| InChIKey | CUANPHQFGINFHC-GOJREDGKSA-N |
| XLogP | 6.29 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.13 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|