C26H24Br2Cl2N4O3 — CID 72514443
3-chloro-N-[[3,5-dibromo-4-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethoxy]phenyl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72514443) has the molecular formula C26H24Br2Cl2N4O3 and a molecular weight of 671.22 g/mol. Its IUPAC name is 3-chloro-N-[[3,5-dibromo-4-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethoxy]phenyl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[[3,5-dibromo-4-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethoxy]phenyl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72514443 |
| Molecular Formula | C26H24Br2Cl2N4O3 |
| Molecular Weight | 671.22 g/mol |
| Exact Mass | 667.96 |
| IUPAC Name | 3-chloro-N-[[3,5-dibromo-4-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethoxy]phenyl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(NN=Cc1cc(Br)c(OCCN2CCN(c3ccc(Cl)cc3)CC2)c(Br)c1)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C26H24Br2Cl2N4O3/c27-21-13-17(16-31-32-26(36)18-1-6-24(35)23(30)15-18)14-22(28)25(21)37-12-11-33-7-9-34(10-8-33)20-4-2-19(29)3-5-20/h1-6,13-16,35H,7-12H2,(H,32,36) |
| InChIKey | RISDPHYEVUKNDT-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.22 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|