C31H29Cl2N3O5S — CID 87419201
3-chloro-N-[(E)-[4-[2-[4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethoxy]-3,5-dimethoxyphenyl]methylideneamino]-4-hydroxybenzamide (PubChem CID 87419201) has the molecular formula C31H29Cl2N3O5S and a molecular weight of 626.56 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[2-[4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethoxy]-3,5-dimethoxyphenyl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[2-[4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethoxy]-3,5-dimethoxyphenyl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 87419201 |
| Molecular Formula | C31H29Cl2N3O5S |
| Molecular Weight | 626.56 g/mol |
| Exact Mass | 625.12 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[2-[4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethoxy]-3,5-dimethoxyphenyl]methylideneamino]-4-hydroxybenzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)cc(OC)c1OCCN1CCc2sccc2C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H29Cl2N3O5S/c1-39-26-15-19(18-34-35-31(38)21-5-8-25(37)24(33)17-21)16-27(40-2)30(26)41-13-12-36-11-9-28-23(10-14-42-28)29(36)20-3-6-22(32)7-4-20/h3-8,10,14-18,29,37H,9,11-13H2,1-2H3,(H,35,38)/b34-18+ |
| InChIKey | ZGULUYDAOBCKGL-FABQOPTDSA-N |
| XLogP | 6.57 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|