C28H29Cl2N3O5 — CID 87419292
3-chloro-N-[(E)-[4-[2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]ethoxy]-2-methoxyphenyl]methylideneamino]-4-hydroxybenzamide (PubChem CID 87419292) has the molecular formula C28H29Cl2N3O5 and a molecular weight of 558.46 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]ethoxy]-2-methoxyphenyl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]ethoxy]-2-methoxyphenyl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 87419292 |
| Molecular Formula | C28H29Cl2N3O5 |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]ethoxy]-2-methoxyphenyl]methylideneamino]-4-hydroxybenzamide |
| SMILES | COc1cc(OCCN2CCC(O)(c3ccc(Cl)cc3)CC2)ccc1/C=N/NC(=O)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C28H29Cl2N3O5/c1-37-26-17-23(8-2-20(26)18-31-32-27(35)19-3-9-25(34)24(30)16-19)38-15-14-33-12-10-28(36,11-13-33)21-4-6-22(29)7-5-21/h2-9,16-18,34,36H,10-15H2,1H3,(H,32,35)/b31-18+ |
| InChIKey | MEFRMZZQRYQRTL-FDAWAROLSA-N |
| XLogP | 4.83 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|