C29H32ClN3O3 — CID 59091644
N-[(E)-[4-[2-(4-benzylpiperidin-1-yl)ethoxy]-2-methylphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide (PubChem CID 59091644) has the molecular formula C29H32ClN3O3 and a molecular weight of 506.05 g/mol. Its IUPAC name is N-[(E)-[4-[2-(4-benzylpiperidin-1-yl)ethoxy]-2-methylphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide.
| Compound Name | N-[(E)-[4-[2-(4-benzylpiperidin-1-yl)ethoxy]-2-methylphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59091644 |
| Molecular Formula | C29H32ClN3O3 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | N-[(E)-[4-[2-(4-benzylpiperidin-1-yl)ethoxy]-2-methylphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide |
| SMILES | Cc1cc(OCCN2CCC(Cc3ccccc3)CC2)ccc1/C=N/NC(=O)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C29H32ClN3O3/c1-21-17-26(9-7-25(21)20-31-32-29(35)24-8-10-28(34)27(30)19-24)36-16-15-33-13-11-23(12-14-33)18-22-5-3-2-4-6-22/h2-10,17,19-20,23,34H,11-16,18H2,1H3,(H,32,35)/b31-20+ |
| InChIKey | HGDAFCJKRXVOJP-AJBULDERSA-N |
| XLogP | 5.45 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|