C25H28Cl3N3O3 — CID 172918059
3-chloro-N-[(E)-[4-[2-[2-(3,4-dichlorophenyl)ethylamino]ethoxy]-2-methylphenyl]methylideneamino]-4-hydroxybenzamide;molecular hydrogen (PubChem CID 172918059) has the molecular formula C25H28Cl3N3O3 and a molecular weight of 524.88 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[2-[2-(3,4-dichlorophenyl)ethylamino]ethoxy]-2-methylphenyl]methylideneamino]-4-hydroxybenzamide;molecular hydrogen.
| Compound Name | 3-chloro-N-[(E)-[4-[2-[2-(3,4-dichlorophenyl)ethylamino]ethoxy]-2-methylphenyl]methylideneamino]-4-hydroxybenzamide;molecular hydrogen |
|---|---|
| PubChem CID | 172918059 |
| Molecular Formula | C25H28Cl3N3O3 |
| Molecular Weight | 524.88 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[2-[2-(3,4-dichlorophenyl)ethylamino]ethoxy]-2-methylphenyl]methylideneamino]-4-hydroxybenzamide;molecular hydrogen |
| SMILES | Cc1cc(OCCNCCc2ccc(Cl)c(Cl)c2)ccc1/C=N/NC(=O)c1ccc(O)c(Cl)c1.[H][H].[H][H] |
| InChI | InChI=1S/C25H24Cl3N3O3.2H2/c1-16-12-20(34-11-10-29-9-8-17-2-6-21(26)22(27)13-17)5-3-19(16)15-30-31-25(33)18-4-7-24(32)23(28)14-18;;/h2-7,12-15,29,32H,8-11H2,1H3,(H,31,33);2*1H/b30-15+;; |
| InChIKey | YTDDGTJMKVXYOI-RTXDERPASA-N |
| XLogP | 6.13 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.88 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|