C24H22Cl3N3O3 — CID 90971388
3-chloro-N-[(Z)-[4-[2-[(3,4-dichlorophenyl)methylamino]ethoxy]-2-methylphenyl]methylideneamino]-4-hydroxybenzamide (PubChem CID 90971388) has the molecular formula C24H22Cl3N3O3 and a molecular weight of 506.82 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[4-[2-[(3,4-dichlorophenyl)methylamino]ethoxy]-2-methylphenyl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(Z)-[4-[2-[(3,4-dichlorophenyl)methylamino]ethoxy]-2-methylphenyl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 90971388 |
| Molecular Formula | C24H22Cl3N3O3 |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 3-chloro-N-[(Z)-[4-[2-[(3,4-dichlorophenyl)methylamino]ethoxy]-2-methylphenyl]methylideneamino]-4-hydroxybenzamide |
| SMILES | Cc1cc(OCCNCc2ccc(Cl)c(Cl)c2)ccc1/C=N\NC(=O)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C24H22Cl3N3O3/c1-15-10-19(33-9-8-28-13-16-2-6-20(25)21(26)11-16)5-3-18(15)14-29-30-24(32)17-4-7-23(31)22(27)12-17/h2-7,10-12,14,28,31H,8-9,13H2,1H3,(H,30,32)/b29-14- |
| InChIKey | VDTYPOYYQOAZJO-NUJZUDFISA-N |
| XLogP | 5.59 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|