C26H31Cl2N3O4 — CID 172964646
3-chloro-N-[(E)-[4-[2-[[1-(4-chlorophenyl)-3-hydroxypropan-2-yl]amino]ethoxy]-2-methylphenyl]methylideneamino]-4-hydroxybenzamide;molecular hydrogen (PubChem CID 172964646) has the molecular formula C26H31Cl2N3O4 and a molecular weight of 520.46 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[2-[[1-(4-chlorophenyl)-3-hydroxypropan-2-yl]amino]ethoxy]-2-methylphenyl]methylideneamino]-4-hydroxybenzamide;molecular hydrogen.
| Compound Name | 3-chloro-N-[(E)-[4-[2-[[1-(4-chlorophenyl)-3-hydroxypropan-2-yl]amino]ethoxy]-2-methylphenyl]methylideneamino]-4-hydroxybenzamide;molecular hydrogen |
|---|---|
| PubChem CID | 172964646 |
| Molecular Formula | C26H31Cl2N3O4 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[2-[[1-(4-chlorophenyl)-3-hydroxypropan-2-yl]amino]ethoxy]-2-methylphenyl]methylideneamino]-4-hydroxybenzamide;molecular hydrogen |
| SMILES | Cc1cc(OCCNC(CO)Cc2ccc(Cl)cc2)ccc1/C=N/NC(=O)c1ccc(O)c(Cl)c1.[H][H].[H][H] |
| InChI | InChI=1S/C26H27Cl2N3O4.2H2/c1-17-12-23(35-11-10-29-22(16-32)13-18-2-6-21(27)7-3-18)8-4-20(17)15-30-31-26(34)19-5-9-25(33)24(28)14-19;;/h2-9,12,14-15,22,29,32-33H,10-11,13,16H2,1H3,(H,31,34);2*1H/b30-15+;; |
| InChIKey | MQGVBIGFVPVAKO-RTXDERPASA-N |
| XLogP | 4.84 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|