C28H32ClN3O3 — CID 90718602
3-chloro-N-[(Z)-[3,5-dimethyl-4-[2-[(4-propan-2-ylphenyl)methylamino]ethoxy]phenyl]methylideneamino]-4-hydroxybenzamide (PubChem CID 90718602) has the molecular formula C28H32ClN3O3 and a molecular weight of 494.04 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[3,5-dimethyl-4-[2-[(4-propan-2-ylphenyl)methylamino]ethoxy]phenyl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(Z)-[3,5-dimethyl-4-[2-[(4-propan-2-ylphenyl)methylamino]ethoxy]phenyl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 90718602 |
| Molecular Formula | C28H32ClN3O3 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 3-chloro-N-[(Z)-[3,5-dimethyl-4-[2-[(4-propan-2-ylphenyl)methylamino]ethoxy]phenyl]methylideneamino]-4-hydroxybenzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccc(O)c(Cl)c2)cc(C)c1OCCNCc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C28H32ClN3O3/c1-18(2)23-7-5-21(6-8-23)16-30-11-12-35-27-19(3)13-22(14-20(27)4)17-31-32-28(34)24-9-10-26(33)25(29)15-24/h5-10,13-15,17-18,30,33H,11-12,16H2,1-4H3,(H,32,34)/b31-17- |
| InChIKey | RUIAMNSGRALIHE-LJUMEUDFSA-N |
| XLogP | 5.72 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|