C29H28ClN3O3S — CID 90855467
3-chloro-4-hydroxy-N-[(Z)-[3-methyl-5-phenyl-4-[2-(2-thiophen-2-ylethylamino)ethoxy]phenyl]methylideneamino]benzamide (PubChem CID 90855467) has the molecular formula C29H28ClN3O3S and a molecular weight of 534.08 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(Z)-[3-methyl-5-phenyl-4-[2-(2-thiophen-2-ylethylamino)ethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(Z)-[3-methyl-5-phenyl-4-[2-(2-thiophen-2-ylethylamino)ethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 90855467 |
| Molecular Formula | C29H28ClN3O3S |
| Molecular Weight | 534.08 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(Z)-[3-methyl-5-phenyl-4-[2-(2-thiophen-2-ylethylamino)ethoxy]phenyl]methylideneamino]benzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccc(O)c(Cl)c2)cc(-c2ccccc2)c1OCCNCCc1cccs1 |
| InChI | InChI=1S/C29H28ClN3O3S/c1-20-16-21(19-32-33-29(35)23-9-10-27(34)26(30)18-23)17-25(22-6-3-2-4-7-22)28(20)36-14-13-31-12-11-24-8-5-15-37-24/h2-10,15-19,31,34H,11-14H2,1H3,(H,33,35)/b32-19- |
| InChIKey | LSWHNDOIKIQINF-MZFJOGFUSA-N |
| XLogP | 6.06 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.08 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|