C26H19Cl3N2O4 — CID 5021305
N-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 5021305) has the molecular formula C26H19Cl3N2O4 and a molecular weight of 529.81 g/mol. Its IUPAC name is N-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 5021305 |
| Molecular Formula | C26H19Cl3N2O4 |
| Molecular Weight | 529.81 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | N-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2cc3ccccc3cc2O)cc(Cl)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H19Cl3N2O4/c1-34-24-10-16(9-22(29)25(24)35-14-15-6-7-20(27)21(28)8-15)13-30-31-26(33)19-11-17-4-2-3-5-18(17)12-23(19)32/h2-13,32H,14H2,1H3,(H,31,33) |
| InChIKey | QBKKBZBBXVUEPB-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.81 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|