C25H17Cl2IN2O3 — CID 3272853
N-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 3272853) has the molecular formula C25H17Cl2IN2O3 and a molecular weight of 591.23 g/mol. Its IUPAC name is N-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3272853 |
| Molecular Formula | C25H17Cl2IN2O3 |
| Molecular Weight | 591.23 g/mol |
| Exact Mass | 589.97 |
| IUPAC Name | N-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | O=C(NN=Cc1ccc(OCc2ccc(Cl)c(Cl)c2)c(I)c1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C25H17Cl2IN2O3/c26-20-7-5-16(9-21(20)27)14-33-24-8-6-15(10-22(24)28)13-29-30-25(32)19-11-17-3-1-2-4-18(17)12-23(19)31/h1-13,31H,14H2,(H,30,32) |
| InChIKey | HSVFOAUKQVZJIY-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.23 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|