C25H18FIN2O3 — CID 3926735
N-[[4-[(2-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 3926735) has the molecular formula C25H18FIN2O3 and a molecular weight of 540.33 g/mol. Its IUPAC name is N-[[4-[(2-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[[4-[(2-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3926735 |
| Molecular Formula | C25H18FIN2O3 |
| Molecular Weight | 540.33 g/mol |
| Exact Mass | 540.03 |
| IUPAC Name | N-[[4-[(2-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | O=C(NN=Cc1ccc(OCc2ccccc2F)c(I)c1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C25H18FIN2O3/c26-21-8-4-3-7-19(21)15-32-24-10-9-16(11-22(24)27)14-28-29-25(31)20-12-17-5-1-2-6-18(17)13-23(20)30/h1-14,30H,15H2,(H,29,31) |
| InChIKey | ZUYQCKUJDAHIQY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.33 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|