C21H16I2N2O3 — CID 5234425
N-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 5234425) has the molecular formula C21H16I2N2O3 and a molecular weight of 598.18 g/mol. Its IUPAC name is N-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 5234425 |
| Molecular Formula | C21H16I2N2O3 |
| Molecular Weight | 598.18 g/mol |
| Exact Mass | 597.93 |
| IUPAC Name | N-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | C=CCOc1c(I)cc(C=NNC(=O)c2cc3ccccc3cc2O)cc1I |
| InChI | InChI=1S/C21H16I2N2O3/c1-2-7-28-20-17(22)8-13(9-18(20)23)12-24-25-21(27)16-10-14-5-3-4-6-15(14)11-19(16)26/h2-6,8-12,26H,1,7H2,(H,25,27) |
| InChIKey | PONQWXZWNOYNCH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.18 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|