C17H14I2N2O3 — CID 3927350
N-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-3-hydroxybenzamide (PubChem CID 3927350) has the molecular formula C17H14I2N2O3 and a molecular weight of 548.12 g/mol. Its IUPAC name is N-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-3-hydroxybenzamide.
| Compound Name | N-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 3927350 |
| Molecular Formula | C17H14I2N2O3 |
| Molecular Weight | 548.12 g/mol |
| Exact Mass | 547.91 |
| IUPAC Name | N-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-3-hydroxybenzamide |
| SMILES | C=CCOc1c(I)cc(C=NNC(=O)c2cccc(O)c2)cc1I |
| InChI | InChI=1S/C17H14I2N2O3/c1-2-6-24-16-14(18)7-11(8-15(16)19)10-20-21-17(23)12-4-3-5-13(22)9-12/h2-5,7-10,22H,1,6H2,(H,21,23) |
| InChIKey | MHIFIMIGGOLSQS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.12 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|