C23H17ClN4O4 — CID 22999322
3-chloro-N-[(E)-[4-[(3-cyanobenzoyl)amino]-2-methoxyphenyl]methylideneamino]-4-hydroxybenzamide (PubChem CID 22999322) has the molecular formula C23H17ClN4O4 and a molecular weight of 448.87 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[(3-cyanobenzoyl)amino]-2-methoxyphenyl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[(3-cyanobenzoyl)amino]-2-methoxyphenyl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 22999322 |
| Molecular Formula | C23H17ClN4O4 |
| Molecular Weight | 448.87 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[(3-cyanobenzoyl)amino]-2-methoxyphenyl]methylideneamino]-4-hydroxybenzamide |
| SMILES | COc1cc(NC(=O)c2cccc(C#N)c2)ccc1/C=N/NC(=O)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C23H17ClN4O4/c1-32-21-11-18(27-22(30)15-4-2-3-14(9-15)12-25)7-5-17(21)13-26-28-23(31)16-6-8-20(29)19(24)10-16/h2-11,13,29H,1H3,(H,27,30)(H,28,31)/b26-13+ |
| InChIKey | OSDRGNBGEUZYIN-LGJNPRDNSA-N |
| XLogP | 3.94 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.87 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|