C20H15BrClN3O5 — CID 59091783
5-bromo-N-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-3-methoxyphenyl]furan-2-carboxamide (PubChem CID 59091783) has the molecular formula C20H15BrClN3O5 and a molecular weight of 492.71 g/mol. Its IUPAC name is 5-bromo-N-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-3-methoxyphenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-3-methoxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 59091783 |
| Molecular Formula | C20H15BrClN3O5 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 490.99 |
| IUPAC Name | 5-bromo-N-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-3-methoxyphenyl]furan-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc(Br)o2)ccc1/C=N/NC(=O)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C20H15BrClN3O5/c1-29-17-9-13(24-20(28)16-6-7-18(21)30-16)4-2-12(17)10-23-25-19(27)11-3-5-15(26)14(22)8-11/h2-10,26H,1H3,(H,24,28)(H,25,27)/b23-10+ |
| InChIKey | FOPBUGJRGVTDRM-AUEPDCJTSA-N |
| XLogP | 4.43 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|