C26H20N4O4S — CID 67483206
N-[[4-[[2-(1-benzothiophen-3-yl)acetyl]amino]-2-methoxyphenyl]methylideneamino]-3-cyano-4-hydroxybenzamide (PubChem CID 67483206) has the molecular formula C26H20N4O4S and a molecular weight of 484.54 g/mol. Its IUPAC name is N-[[4-[[2-(1-benzothiophen-3-yl)acetyl]amino]-2-methoxyphenyl]methylideneamino]-3-cyano-4-hydroxybenzamide.
| Compound Name | N-[[4-[[2-(1-benzothiophen-3-yl)acetyl]amino]-2-methoxyphenyl]methylideneamino]-3-cyano-4-hydroxybenzamide |
|---|---|
| PubChem CID | 67483206 |
| Molecular Formula | C26H20N4O4S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | N-[[4-[[2-(1-benzothiophen-3-yl)acetyl]amino]-2-methoxyphenyl]methylideneamino]-3-cyano-4-hydroxybenzamide |
| SMILES | COc1cc(NC(=O)Cc2csc3ccccc23)ccc1C=NNC(=O)c1ccc(O)c(C#N)c1 |
| InChI | InChI=1S/C26H20N4O4S/c1-34-23-12-20(29-25(32)11-19-15-35-24-5-3-2-4-21(19)24)8-6-17(23)14-28-30-26(33)16-7-9-22(31)18(10-16)13-27/h2-10,12,14-15,31H,11H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | WADAEPBVKXLUJX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|