C26H16F2N4O3 — CID 72514128
3-cyano-N-[[4-[(3,5-difluorobenzoyl)amino]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72514128) has the molecular formula C26H16F2N4O3 and a molecular weight of 470.44 g/mol. Its IUPAC name is 3-cyano-N-[[4-[(3,5-difluorobenzoyl)amino]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-cyano-N-[[4-[(3,5-difluorobenzoyl)amino]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72514128 |
| Molecular Formula | C26H16F2N4O3 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 3-cyano-N-[[4-[(3,5-difluorobenzoyl)amino]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | N#Cc1cc(C(=O)NN=Cc2ccc(NC(=O)c3cc(F)cc(F)c3)c3ccccc23)ccc1O |
| InChI | InChI=1S/C26H16F2N4O3/c27-19-10-17(11-20(28)12-19)25(34)31-23-7-5-16(21-3-1-2-4-22(21)23)14-30-32-26(35)15-6-8-24(33)18(9-15)13-29/h1-12,14,33H,(H,31,34)(H,32,35) |
| InChIKey | XRPURRSMVRXNIT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|