C25H22N4O3 — CID 72514484
3-cyano-N-[[4-(cyclopentanecarbonylamino)naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72514484) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is 3-cyano-N-[[4-(cyclopentanecarbonylamino)naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-cyano-N-[[4-(cyclopentanecarbonylamino)naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72514484 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 3-cyano-N-[[4-(cyclopentanecarbonylamino)naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | N#Cc1cc(C(=O)NN=Cc2ccc(NC(=O)C3CCCC3)c3ccccc23)ccc1O |
| InChI | InChI=1S/C25H22N4O3/c26-14-19-13-17(10-12-23(19)30)25(32)29-27-15-18-9-11-22(21-8-4-3-7-20(18)21)28-24(31)16-5-1-2-6-16/h3-4,7-13,15-16,30H,1-2,5-6H2,(H,28,31)(H,29,32) |
| InChIKey | DXJBKNOBKOYCAO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|