C23H27N3O2 — CID 5121259
4-(cyclohexanecarbonylamino)-N-[(2,4-dimethylphenyl)methylideneamino]benzamide (PubChem CID 5121259) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-(cyclohexanecarbonylamino)-N-[(2,4-dimethylphenyl)methylideneamino]benzamide.
| Compound Name | 4-(cyclohexanecarbonylamino)-N-[(2,4-dimethylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 5121259 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 4-(cyclohexanecarbonylamino)-N-[(2,4-dimethylphenyl)methylideneamino]benzamide |
| SMILES | Cc1ccc(C=NNC(=O)c2ccc(NC(=O)C3CCCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H27N3O2/c1-16-8-9-20(17(2)14-16)15-24-26-23(28)19-10-12-21(13-11-19)25-22(27)18-6-4-3-5-7-18/h8-15,18H,3-7H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | UHKDABCOXVBYEQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|