C25H19F3N4O4 — CID 11081564
3-cyano-4-hydroxy-N-[(E)-[2-methoxy-4-[[2-[3-(trifluoromethyl)phenyl]acetyl]amino]phenyl]methylideneamino]benzamide (PubChem CID 11081564) has the molecular formula C25H19F3N4O4 and a molecular weight of 496.45 g/mol. Its IUPAC name is 3-cyano-4-hydroxy-N-[(E)-[2-methoxy-4-[[2-[3-(trifluoromethyl)phenyl]acetyl]amino]phenyl]methylideneamino]benzamide.
| Compound Name | 3-cyano-4-hydroxy-N-[(E)-[2-methoxy-4-[[2-[3-(trifluoromethyl)phenyl]acetyl]amino]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 11081564 |
| Molecular Formula | C25H19F3N4O4 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 3-cyano-4-hydroxy-N-[(E)-[2-methoxy-4-[[2-[3-(trifluoromethyl)phenyl]acetyl]amino]phenyl]methylideneamino]benzamide |
| SMILES | COc1cc(NC(=O)Cc2cccc(C(F)(F)F)c2)ccc1/C=N/NC(=O)c1ccc(O)c(C#N)c1 |
| InChI | InChI=1S/C25H19F3N4O4/c1-36-22-12-20(31-23(34)10-15-3-2-4-19(9-15)25(26,27)28)7-5-17(22)14-30-32-24(35)16-6-8-21(33)18(11-16)13-29/h2-9,11-12,14,33H,10H2,1H3,(H,31,34)(H,32,35)/b30-14+ |
| InChIKey | JPCQGICVJNWEJT-AMVVHIIESA-N |
| XLogP | 4.24 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|