C25H17F3N4O2 — CID 11826682
3-cyano-4-hydroxy-N-[(E)-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-4-yl]methylideneamino]benzamide (PubChem CID 11826682) has the molecular formula C25H17F3N4O2 and a molecular weight of 462.43 g/mol. Its IUPAC name is 3-cyano-4-hydroxy-N-[(E)-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-4-yl]methylideneamino]benzamide.
| Compound Name | 3-cyano-4-hydroxy-N-[(E)-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 11826682 |
| Molecular Formula | C25H17F3N4O2 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 3-cyano-4-hydroxy-N-[(E)-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-4-yl]methylideneamino]benzamide |
| SMILES | N#Cc1cc(C(=O)N/N=C/c2cccc3c2ccn3Cc2ccc(C(F)(F)F)cc2)ccc1O |
| InChI | InChI=1S/C25H17F3N4O2/c26-25(27,28)20-7-4-16(5-8-20)15-32-11-10-21-18(2-1-3-22(21)32)14-30-31-24(34)17-6-9-23(33)19(12-17)13-29/h1-12,14,33H,15H2,(H,31,34)/b30-14+ |
| InChIKey | HFPOQOQBQMPPBL-AMVVHIIESA-N |
| XLogP | 5.05 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|