C25H20ClN3O4 — CID 154682754
methyl 4-[[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]indol-1-yl]methyl]benzoate (PubChem CID 154682754) has the molecular formula C25H20ClN3O4 and a molecular weight of 461.91 g/mol. Its IUPAC name is methyl 4-[[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]indol-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]indol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 154682754 |
| Molecular Formula | C25H20ClN3O4 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | methyl 4-[[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]indol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2ccc3c(/C=N/NC(=O)c4ccc(O)c(Cl)c4)cccc32)cc1 |
| InChI | InChI=1S/C25H20ClN3O4/c1-33-25(32)17-7-5-16(6-8-17)15-29-12-11-20-19(3-2-4-22(20)29)14-27-28-24(31)18-9-10-23(30)21(26)13-18/h2-14,30H,15H2,1H3,(H,28,31)/b27-14+ |
| InChIKey | INDTZFWUXFMCNP-MZJWZYIUSA-N |
| XLogP | 4.60 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|