C33H31N5O5 — CID 59091817
ethyl 1-[4-[[4-[(E)-[(3-cyano-4-hydroxybenzoyl)hydrazinylidene]methyl]indol-1-yl]methyl]benzoyl]piperidine-4-carboxylate (PubChem CID 59091817) has the molecular formula C33H31N5O5 and a molecular weight of 577.64 g/mol. Its IUPAC name is ethyl 1-[4-[[4-[(E)-[(3-cyano-4-hydroxybenzoyl)hydrazinylidene]methyl]indol-1-yl]methyl]benzoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[[4-[(E)-[(3-cyano-4-hydroxybenzoyl)hydrazinylidene]methyl]indol-1-yl]methyl]benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 59091817 |
| Molecular Formula | C33H31N5O5 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | ethyl 1-[4-[[4-[(E)-[(3-cyano-4-hydroxybenzoyl)hydrazinylidene]methyl]indol-1-yl]methyl]benzoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc(Cn3ccc4c(/C=N/NC(=O)c5ccc(O)c(C#N)c5)cccc43)cc2)CC1 |
| InChI | InChI=1S/C33H31N5O5/c1-2-43-33(42)24-12-15-37(16-13-24)32(41)23-8-6-22(7-9-23)21-38-17-14-28-26(4-3-5-29(28)38)20-35-36-31(40)25-10-11-30(39)27(18-25)19-34/h3-11,14,17-18,20,24,39H,2,12-13,15-16,21H2,1H3,(H,36,40)/b35-20+ |
| InChIKey | PDVNKWKIASGSMT-JEPNHJGPSA-N |
| XLogP | 4.45 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|