C22H26ClN3O4 — CID 119797292
ethyl 1-[4-[(3-aminobenzoyl)amino]benzoyl]piperidine-4-carboxylate;hydrochloride (PubChem CID 119797292) has the molecular formula C22H26ClN3O4 and a molecular weight of 431.92 g/mol. Its IUPAC name is ethyl 1-[4-[(3-aminobenzoyl)amino]benzoyl]piperidine-4-carboxylate;hydrochloride.
| Compound Name | ethyl 1-[4-[(3-aminobenzoyl)amino]benzoyl]piperidine-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119797292 |
| Molecular Formula | C22H26ClN3O4 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | ethyl 1-[4-[(3-aminobenzoyl)amino]benzoyl]piperidine-4-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc(NC(=O)c3cccc(N)c3)cc2)CC1.Cl |
| InChI | InChI=1S/C22H25N3O4.ClH/c1-2-29-22(28)16-10-12-25(13-11-16)21(27)15-6-8-19(9-7-15)24-20(26)17-4-3-5-18(23)14-17;/h3-9,14,16H,2,10-13,23H2,1H3,(H,24,26);1H |
| InChIKey | PDBWBOUJHNLDCJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|