C19H23N3O3 — CID 43923306
ethyl 1-[4-(imidazol-1-ylmethyl)benzoyl]piperidine-4-carboxylate (PubChem CID 43923306) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is ethyl 1-[4-(imidazol-1-ylmethyl)benzoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-(imidazol-1-ylmethyl)benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 43923306 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | ethyl 1-[4-(imidazol-1-ylmethyl)benzoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc(Cn3ccnc3)cc2)CC1 |
| InChI | InChI=1S/C19H23N3O3/c1-2-25-19(24)17-7-10-22(11-8-17)18(23)16-5-3-15(4-6-16)13-21-12-9-20-14-21/h3-6,9,12,14,17H,2,7-8,10-11,13H2,1H3 |
| InChIKey | RTCJNKVHLOPRPF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |