C24H17ClN4O2 — CID 154682763
3-chloro-N-[(E)-[1-[(4-cyanophenyl)methyl]indol-4-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 154682763) has the molecular formula C24H17ClN4O2 and a molecular weight of 428.88 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[1-[(4-cyanophenyl)methyl]indol-4-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[1-[(4-cyanophenyl)methyl]indol-4-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 154682763 |
| Molecular Formula | C24H17ClN4O2 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 3-chloro-N-[(E)-[1-[(4-cyanophenyl)methyl]indol-4-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | N#Cc1ccc(Cn2ccc3c(/C=N/NC(=O)c4ccc(O)c(Cl)c4)cccc32)cc1 |
| InChI | InChI=1S/C24H17ClN4O2/c25-21-12-18(8-9-23(21)30)24(31)28-27-14-19-2-1-3-22-20(19)10-11-29(22)15-17-6-4-16(13-26)5-7-17/h1-12,14,30H,15H2,(H,28,31)/b27-14+ |
| InChIKey | SGIQXAVYSFLSMO-MZJWZYIUSA-N |
| XLogP | 4.68 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|