C27H18ClN5O2S — CID 59092164
N-[(E)-[1-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methyl]indol-4-yl]methylideneamino]-3-cyano-4-hydroxybenzamide (PubChem CID 59092164) has the molecular formula C27H18ClN5O2S and a molecular weight of 511.99 g/mol. Its IUPAC name is N-[(E)-[1-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methyl]indol-4-yl]methylideneamino]-3-cyano-4-hydroxybenzamide.
| Compound Name | N-[(E)-[1-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methyl]indol-4-yl]methylideneamino]-3-cyano-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59092164 |
| Molecular Formula | C27H18ClN5O2S |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | N-[(E)-[1-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methyl]indol-4-yl]methylideneamino]-3-cyano-4-hydroxybenzamide |
| SMILES | N#Cc1cc(C(=O)N/N=C/c2cccc3c2ccn3Cc2csc(-c3ccc(Cl)cc3)n2)ccc1O |
| InChI | InChI=1S/C27H18ClN5O2S/c28-21-7-4-17(5-8-21)27-31-22(16-36-27)15-33-11-10-23-19(2-1-3-24(23)33)14-30-32-26(35)18-6-9-25(34)20(12-18)13-29/h1-12,14,16,34H,15H2,(H,32,35)/b30-14+ |
| InChIKey | OHKPORZNVQHVCU-AMVVHIIESA-N |
| XLogP | 5.81 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|