C22H14N4O4 — CID 59092003
3-cyano-N-[(E)-[1-(furan-3-carbonyl)indol-4-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 59092003) has the molecular formula C22H14N4O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is 3-cyano-N-[(E)-[1-(furan-3-carbonyl)indol-4-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-cyano-N-[(E)-[1-(furan-3-carbonyl)indol-4-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59092003 |
| Molecular Formula | C22H14N4O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 3-cyano-N-[(E)-[1-(furan-3-carbonyl)indol-4-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | N#Cc1cc(C(=O)N/N=C/c2cccc3c2ccn3C(=O)c2ccoc2)ccc1O |
| InChI | InChI=1S/C22H14N4O4/c23-11-17-10-14(4-5-20(17)27)21(28)25-24-12-15-2-1-3-19-18(15)6-8-26(19)22(29)16-7-9-30-13-16/h1-10,12-13,27H,(H,25,28)/b24-12+ |
| InChIKey | FMSYFIUHENXSJN-WYMPLXKRSA-N |
| XLogP | 3.26 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|