C24H16Cl2N4O2 — CID 72514252
3-cyano-N-[[1-[(3,4-dichlorophenyl)methyl]indol-5-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72514252) has the molecular formula C24H16Cl2N4O2 and a molecular weight of 463.32 g/mol. Its IUPAC name is 3-cyano-N-[[1-[(3,4-dichlorophenyl)methyl]indol-5-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-cyano-N-[[1-[(3,4-dichlorophenyl)methyl]indol-5-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72514252 |
| Molecular Formula | C24H16Cl2N4O2 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 3-cyano-N-[[1-[(3,4-dichlorophenyl)methyl]indol-5-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | N#Cc1cc(C(=O)NN=Cc2ccc3c(ccn3Cc3ccc(Cl)c(Cl)c3)c2)ccc1O |
| InChI | InChI=1S/C24H16Cl2N4O2/c25-20-4-1-16(10-21(20)26)14-30-8-7-17-9-15(2-5-22(17)30)13-28-29-24(32)18-3-6-23(31)19(11-18)12-27/h1-11,13,31H,14H2,(H,29,32) |
| InChIKey | SBMXTDSOCUQZKI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|