C27H22N4O2 — CID 87419048
3-amino-4-hydroxy-N-[(E)-[1-(naphthalen-1-ylmethyl)indol-4-yl]methylideneamino]benzamide (PubChem CID 87419048) has the molecular formula C27H22N4O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is 3-amino-4-hydroxy-N-[(E)-[1-(naphthalen-1-ylmethyl)indol-4-yl]methylideneamino]benzamide.
| Compound Name | 3-amino-4-hydroxy-N-[(E)-[1-(naphthalen-1-ylmethyl)indol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 87419048 |
| Molecular Formula | C27H22N4O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 3-amino-4-hydroxy-N-[(E)-[1-(naphthalen-1-ylmethyl)indol-4-yl]methylideneamino]benzamide |
| SMILES | Nc1cc(C(=O)N/N=C/c2cccc3c2ccn3Cc2cccc3ccccc23)ccc1O |
| InChI | InChI=1S/C27H22N4O2/c28-24-15-19(11-12-26(24)32)27(33)30-29-16-20-7-4-10-25-23(20)13-14-31(25)17-21-8-3-6-18-5-1-2-9-22(18)21/h1-16,32H,17,28H2,(H,30,33)/b29-16+ |
| InChIKey | NGTHBXLLRIJGSB-MUFRIFMGSA-N |
| XLogP | 4.89 |
| TPSA | 92.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|