C23H24N4O4 — CID 87419079
3-amino-N-[(E)-[5-[[2-(ethylamino)-2-oxoethoxy]methyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 87419079) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 3-amino-N-[(E)-[5-[[2-(ethylamino)-2-oxoethoxy]methyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-amino-N-[(E)-[5-[[2-(ethylamino)-2-oxoethoxy]methyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 87419079 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 3-amino-N-[(E)-[5-[[2-(ethylamino)-2-oxoethoxy]methyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | CCNC(=O)COCc1cccc2c(/C=N/NC(=O)c3ccc(O)c(N)c3)cccc12 |
| InChI | InChI=1S/C23H24N4O4/c1-2-25-22(29)14-31-13-17-6-4-7-18-16(5-3-8-19(17)18)12-26-27-23(30)15-9-10-21(28)20(24)11-15/h3-12,28H,2,13-14,24H2,1H3,(H,25,29)(H,27,30)/b26-12+ |
| InChIKey | XNRYMGZNQQTJCR-RPPGKUMJSA-N |
| XLogP | 2.54 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|