C28H30ClN3O4 — CID 72514331
3-chloro-N-[[4-[2-(5-ethyl-2-methylpiperidin-1-yl)-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72514331) has the molecular formula C28H30ClN3O4 and a molecular weight of 508.02 g/mol. Its IUPAC name is 3-chloro-N-[[4-[2-(5-ethyl-2-methylpiperidin-1-yl)-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[[4-[2-(5-ethyl-2-methylpiperidin-1-yl)-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72514331 |
| Molecular Formula | C28H30ClN3O4 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 3-chloro-N-[[4-[2-(5-ethyl-2-methylpiperidin-1-yl)-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | CCC1CCC(C)N(C(=O)COc2ccc(C=NNC(=O)c3ccc(O)c(Cl)c3)c3ccccc23)C1 |
| InChI | InChI=1S/C28H30ClN3O4/c1-3-19-9-8-18(2)32(16-19)27(34)17-36-26-13-11-21(22-6-4-5-7-23(22)26)15-30-31-28(35)20-10-12-25(33)24(29)14-20/h4-7,10-15,18-19,33H,3,8-9,16-17H2,1-2H3,(H,31,35) |
| InChIKey | AURBMGSVJNOMFR-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|