C29H31ClN4O6 — CID 59092417
tert-butyl 4-[2-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyacetyl]piperazine-1-carboxylate (PubChem CID 59092417) has the molecular formula C29H31ClN4O6 and a molecular weight of 567.04 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyacetyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59092417 |
| Molecular Formula | C29H31ClN4O6 |
| Molecular Weight | 567.04 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | tert-butyl 4-[2-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyacetyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)COc2ccc(/C=N/NC(=O)c3ccc(O)c(Cl)c3)c3ccccc23)CC1 |
| InChI | InChI=1S/C29H31ClN4O6/c1-29(2,3)40-28(38)34-14-12-33(13-15-34)26(36)18-39-25-11-9-20(21-6-4-5-7-22(21)25)17-31-32-27(37)19-8-10-24(35)23(30)16-19/h4-11,16-17,35H,12-15,18H2,1-3H3,(H,32,37)/b31-17+ |
| InChIKey | XMFFCNSPDYCICJ-KBVAKVRCSA-N |
| XLogP | 4.42 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.04 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|