C30H25ClF3N5O4 — CID 59091699
3-chloro-4-hydroxy-N-[(E)-[4-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethoxy]naphthalen-1-yl]methylideneamino]benzamide (PubChem CID 59091699) has the molecular formula C30H25ClF3N5O4 and a molecular weight of 612.01 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(E)-[4-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethoxy]naphthalen-1-yl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(E)-[4-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethoxy]naphthalen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 59091699 |
| Molecular Formula | C30H25ClF3N5O4 |
| Molecular Weight | 612.01 g/mol |
| Exact Mass | 611.15 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(E)-[4-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethoxy]naphthalen-1-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccc(OCC(=O)N2CCN(c3ccc(C(F)(F)F)cn3)CC2)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C30H25ClF3N5O4/c31-24-15-19(5-8-25(24)40)29(42)37-36-16-20-6-9-26(23-4-2-1-3-22(20)23)43-18-28(41)39-13-11-38(12-14-39)27-10-7-21(17-35-27)30(32,33)34/h1-10,15-17,40H,11-14,18H2,(H,37,42)/b36-16+ |
| InChIKey | BIXMDIDOHIYSHR-ODQASSKESA-N |
| XLogP | 5.10 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.01 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|