C35H37ClN4O4 — CID 72514327
3-chloro-4-hydroxy-N-[[4-[2-[(4-methylphenyl)methyl-[2-(1-methylpyrrolidin-2-yl)ethyl]amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]benzamide (PubChem CID 72514327) has the molecular formula C35H37ClN4O4 and a molecular weight of 613.16 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[[4-[2-[(4-methylphenyl)methyl-[2-(1-methylpyrrolidin-2-yl)ethyl]amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[[4-[2-[(4-methylphenyl)methyl-[2-(1-methylpyrrolidin-2-yl)ethyl]amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 72514327 |
| Molecular Formula | C35H37ClN4O4 |
| Molecular Weight | 613.16 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[[4-[2-[(4-methylphenyl)methyl-[2-(1-methylpyrrolidin-2-yl)ethyl]amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]benzamide |
| SMILES | Cc1ccc(CN(CCC2CCCN2C)C(=O)COc2ccc(C=NNC(=O)c3ccc(O)c(Cl)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C35H37ClN4O4/c1-24-9-11-25(12-10-24)22-40(19-17-28-6-5-18-39(28)2)34(42)23-44-33-16-14-27(29-7-3-4-8-30(29)33)21-37-38-35(43)26-13-15-32(41)31(36)20-26/h3-4,7-16,20-21,28,41H,5-6,17-19,22-23H2,1-2H3,(H,38,43) |
| InChIKey | HKIZPBOWBPQJKS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.16 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|