C33H28ClN3O5 — CID 72513791
3-chloro-N-[[4-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72513791) has the molecular formula C33H28ClN3O5 and a molecular weight of 582.06 g/mol. Its IUPAC name is 3-chloro-N-[[4-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[[4-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72513791 |
| Molecular Formula | C33H28ClN3O5 |
| Molecular Weight | 582.06 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | 3-chloro-N-[[4-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(NN=Cc1ccc(OCC(=O)N(CCc2ccccc2)Cc2ccco2)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C33H28ClN3O5/c34-29-19-24(12-14-30(29)38)33(40)36-35-20-25-13-15-31(28-11-5-4-10-27(25)28)42-22-32(39)37(21-26-9-6-18-41-26)17-16-23-7-2-1-3-8-23/h1-15,18-20,38H,16-17,21-22H2,(H,36,40) |
| InChIKey | OPKDOHXKZWQQJJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.06 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|