C34H29ClN4O4 — CID 59091889
N-[(E)-[4-[2-[benzyl(2-pyridin-2-ylethyl)amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide (PubChem CID 59091889) has the molecular formula C34H29ClN4O4 and a molecular weight of 593.08 g/mol. Its IUPAC name is N-[(E)-[4-[2-[benzyl(2-pyridin-2-ylethyl)amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide.
| Compound Name | N-[(E)-[4-[2-[benzyl(2-pyridin-2-ylethyl)amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59091889 |
| Molecular Formula | C34H29ClN4O4 |
| Molecular Weight | 593.08 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | N-[(E)-[4-[2-[benzyl(2-pyridin-2-ylethyl)amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide |
| SMILES | O=C(N/N=C/c1ccc(OCC(=O)N(CCc2ccccn2)Cc2ccccc2)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C34H29ClN4O4/c35-30-20-25(13-15-31(30)40)34(42)38-37-21-26-14-16-32(29-12-5-4-11-28(26)29)43-23-33(41)39(22-24-8-2-1-3-9-24)19-17-27-10-6-7-18-36-27/h1-16,18,20-21,40H,17,19,22-23H2,(H,38,42)/b37-21+ |
| InChIKey | PFDGDMKVLZCVPM-FDALDRLYSA-N |
| XLogP | 6.01 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.08 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|