C31H30ClN5O6 — CID 72513805
3-chloro-N-[[4-[2-[2-(dimethylamino)ethyl-[(2-nitrophenyl)methyl]amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72513805) has the molecular formula C31H30ClN5O6 and a molecular weight of 604.06 g/mol. Its IUPAC name is 3-chloro-N-[[4-[2-[2-(dimethylamino)ethyl-[(2-nitrophenyl)methyl]amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[[4-[2-[2-(dimethylamino)ethyl-[(2-nitrophenyl)methyl]amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72513805 |
| Molecular Formula | C31H30ClN5O6 |
| Molecular Weight | 604.06 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | 3-chloro-N-[[4-[2-[2-(dimethylamino)ethyl-[(2-nitrophenyl)methyl]amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | CN(C)CCN(Cc1ccccc1[N+](=O)[O-])C(=O)COc1ccc(C=NNC(=O)c2ccc(O)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C31H30ClN5O6/c1-35(2)15-16-36(19-23-7-3-6-10-27(23)37(41)42)30(39)20-43-29-14-12-22(24-8-4-5-9-25(24)29)18-33-34-31(40)21-11-13-28(38)26(32)17-21/h3-14,17-18,38H,15-16,19-20H2,1-2H3,(H,34,40) |
| InChIKey | KDHDPIRELRHLFZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.06 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|